About N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide
N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide (PubChem CID 140748325) has the molecular formula C10H10N4OS
and a molecular weight of 234.28 g/mol. Its IUPAC name is N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide |
| PubChem CID | 140748325 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cccnn1)c1cncs1 |
| InChI | InChI=1S/C10H10N4OS/c1-7(9-5-11-6-16-9)13-10(15)8-3-2-4-12-14-8/h2-7H,1H3,(H,13,15)/t7-/m1/s1 |
| InChIKey | QWEXRHWTPWSHBV-SSDOTTSWSA-N |
| XLogP | 1.42 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide?
The IUPAC name of N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide (CID 140748325) is N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide.
What is the SMILES notation for N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide?
The canonical SMILES for N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide is C[C@@H](NC(=O)c1cccnn1)c1cncs1.
What is the InChIKey of N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide?
The InChIKey is QWEXRHWTPWSHBV-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H10N4OS/c1-7(9-5-11-6-16-9)13-10(15)8-3-2-4-12-14-8/h2-7H,1H3,(H,13,15)/t7-/m1/s1.
What are the key properties of N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide?
N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide has a molecular weight of 234.28 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(1,3-thiazol-5-yl)ethyl]pyridazine-3-carboxamide is sourced from PubChem (CID 140748325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).