C29H37BClN4O2+2 — CID 140748908
CID 140748908 (PubChem CID 140748908) has the molecular formula C29H37BClN4O2+2 and a molecular weight of 519.91 g/mol.
| Compound Name | CID 140748908 |
|---|---|
| PubChem CID | 140748908 |
| Molecular Formula | C29H37BClN4O2+2 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | — |
| SMILES | CCc1ccc(C(=O)Nc2cc(Cl)c(NC(=O)c3ccc(C[N+](C)(C)[B][N+](C)(C)C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C29H37BClN4O2/c1-8-21-9-13-23(14-10-21)28(36)32-26-18-25(31)27(17-20(26)2)33-29(37)24-15-11-22(12-16-24)19-35(6,7)30-34(3,4)5/h9-18H,8,19H2,1-7H3,(H,32,36)(H,33,37)/q+2 |
| InChIKey | MBYLQDFNOBFTJF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|