C39H68O4 — CID 140749244
3-octadeca-9,12-dienoyloxypropyl octadeca-9,12-dienoate (PubChem CID 140749244) has the molecular formula C39H68O4 and a molecular weight of 600.97 g/mol. Its IUPAC name is 3-octadeca-9,12-dienoyloxypropyl octadeca-9,12-dienoate.
| Compound Name | 3-octadeca-9,12-dienoyloxypropyl octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 140749244 |
| Molecular Formula | C39H68O4 |
| Molecular Weight | 600.97 g/mol |
| Exact Mass | 600.51 |
| IUPAC Name | 3-octadeca-9,12-dienoyloxypropyl octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCCCOC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C39H68O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-38(40)42-36-33-37-43-39(41)35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20H,3-10,15-16,21-37H2,1-2H3 |
| InChIKey | QLMWLHQQXXUQKS-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.97 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|