C23H23F2N7O2S — CID 140749496
2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 140749496) has the molecular formula C23H23F2N7O2S and a molecular weight of 499.55 g/mol. Its IUPAC name is 2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 140749496 |
| Molecular Formula | C23H23F2N7O2S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 2-[1-[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexyl)pyrazol-4-yl]pyrazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCOC1CCC(n2cc(-n3cc(-c4nc(C(N)=O)cs4)cn3)c(-c3nc(F)ccc3F)n2)CC1 |
| InChI | InChI=1S/C23H23F2N7O2S/c1-2-34-15-5-3-14(4-6-15)31-11-18(21(30-31)20-16(24)7-8-19(25)29-20)32-10-13(9-27-32)23-28-17(12-35-23)22(26)33/h7-12,14-15H,2-6H2,1H3,(H2,26,33) |
| InChIKey | HLCUAJAKSHFTQL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|