C14H20F3N5O8S — CID 140749595
[7-oxo-2-[[(2S,4R)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140749595) has the molecular formula C14H20F3N5O8S and a molecular weight of 475.40 g/mol. Its IUPAC name is [7-oxo-2-[[(2S,4R)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-[[(2S,4R)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140749595 |
| Molecular Formula | C14H20F3N5O8S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [7-oxo-2-[[(2S,4R)-4-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC[C@@H]1C[C@@H](NC(=O)C(F)(F)F)CN1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H20F3N5O8S/c15-14(16,17)12(24)19-7-3-8(18-4-7)6-29-20-11(23)10-2-1-9-5-21(10)13(25)22(9)30-31(26,27)28/h7-10,18H,1-6H2,(H,19,24)(H,20,23)(H,26,27,28)/t7-,8+,9?,10?/m1/s1 |
| InChIKey | BBASZXGNDHNFTP-XHHQTKHESA-N |
| XLogP | -1.55 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|