C19H40N2O7 — CID 140749769
4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate (PubChem CID 140749769) has the molecular formula C19H40N2O7 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate.
| Compound Name | 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate |
|---|---|
| PubChem CID | 140749769 |
| Molecular Formula | C19H40N2O7 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate |
| SMILES | CC[N+]1(C)CCCCC1.CC[N+]1(C)CCOCC1.COC(=O)[O-].COC(=O)[O-] |
| InChI | InChI=1S/C8H18N.C7H16NO.2C2H4O3/c1-3-9(2)7-5-4-6-8-9;1-3-8(2)4-6-9-7-5-8;2*1-5-2(3)4/h3-8H2,1-2H3;3-7H2,1-2H3;2*1H3,(H,3,4)/q2*+1;;/p-2 |
| InChIKey | YYLXLUZSRQOANO-UHFFFAOYSA-L |
| XLogP | 0.07 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|