About 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate
4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate (PubChem CID 140749769) has the molecular formula C19H40N2O7
and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate.
Molecular Properties
| Compound Name | 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate |
| PubChem CID | 140749769 |
| Molecular Formula | C19H40N2O7 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate |
| SMILES | CC[N+]1(C)CCCCC1.CC[N+]1(C)CCOCC1.COC(=O)[O-].COC(=O)[O-] |
| InChI | InChI=1S/C8H18N.C7H16NO.2C2H4O3/c1-3-9(2)7-5-4-6-8-9;1-3-8(2)4-6-9-7-5-8;2*1-5-2(3)4/h3-8H2,1-2H3;3-7H2,1-2H3;2*1H3,(H,3,4)/q2*+1;;/p-2 |
| InChIKey | YYLXLUZSRQOANO-UHFFFAOYSA-L |
| XLogP | 0.07 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate?
The IUPAC name of 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate (CID 140749769) is 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate.
What is the SMILES notation for 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate?
The canonical SMILES for 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate is CC[N+]1(C)CCCCC1.CC[N+]1(C)CCOCC1.COC(=O)[O-].COC(=O)[O-].
What is the InChIKey of 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate?
The InChIKey is YYLXLUZSRQOANO-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18N.C7H16NO.2C2H4O3/c1-3-9(2)7-5-4-6-8-9;1-3-8(2)4-6-9-7-5-8;2*1-5-2(3)4/h3-8H2,1-2H3;3-7H2,1-2H3;2*1H3,(H,3,4)/q2*+1;;/p-2.
What are the key properties of 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate?
4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate has a molecular weight of 408.54 g/mol, XLogP of 0.07, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-methylmorpholin-4-ium;1-ethyl-1-methylpiperidin-1-ium;methyl carbonate is sourced from PubChem (CID 140749769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).