C28H46O3Si — CID 140749947
(4S,5E)-5-[(3S,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-5,8-dienylidene]-4-[(Z)-6-hydroxyhex-2-enyl]cyclopent-2-en-1-one (PubChem CID 140749947) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (4S,5E)-5-[(3S,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-5,8-dienylidene]-4-[(Z)-6-hydroxyhex-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5E)-5-[(3S,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-5,8-dienylidene]-4-[(Z)-6-hydroxyhex-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 140749947 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (4S,5E)-5-[(3S,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-5,8-dienylidene]-4-[(Z)-6-hydroxyhex-2-enyl]cyclopent-2-en-1-one |
| SMILES | CC/C=C\C/C=C\C[C@@H](C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46O3Si/c1-7-8-9-10-11-15-18-25(31-32(5,6)28(2,3)4)20-21-26-24(19-22-27(26)30)17-14-12-13-16-23-29/h8-9,11-12,14-15,19,21-22,24-25,29H,7,10,13,16-18,20,23H2,1-6H3/b9-8-,14-12-,15-11-,26-21+/t24-,25-/m0/s1 |
| InChIKey | AKLKKLPYXQCNPL-CJSJZMDNSA-N |
| XLogP | 7.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|