C26H44O3Si — CID 140749978
(4S,5S)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-1-hydroxyocta-2,5-dienyl]cyclopent-2-en-1-one (PubChem CID 140749978) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (4S,5S)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-1-hydroxyocta-2,5-dienyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5S)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-1-hydroxyocta-2,5-dienyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 140749978 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (4S,5S)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-1-hydroxyocta-2,5-dienyl]cyclopent-2-en-1-one |
| SMILES | CC/C=C\C/C=C/C(O)[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H44O3Si/c1-7-8-9-11-15-18-23(27)25-22(19-20-24(25)28)17-14-12-10-13-16-21-29-30(5,6)26(2,3)4/h8-9,12,14-15,18-20,22-23,25,27H,7,10-11,13,16-17,21H2,1-6H3/b9-8-,14-12-,18-15+/t22-,23?,25-/m0/s1 |
| InChIKey | KQHQIDFHMQQGGB-OTFVXMRRSA-N |
| XLogP | 6.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|