C14H27F3O2Si — CID 140749985
(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-en-1-ol (PubChem CID 140749985) has the molecular formula C14H27F3O2Si and a molecular weight of 312.45 g/mol. Its IUPAC name is (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-en-1-ol.
| Compound Name | (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-en-1-ol |
|---|---|
| PubChem CID | 140749985 |
| Molecular Formula | C14H27F3O2Si |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C/C=C\CC(F)(F)F)CCO |
| InChI | InChI=1S/C14H27F3O2Si/c1-13(2,3)20(4,5)19-12(9-11-18)8-6-7-10-14(15,16)17/h6-7,12,18H,8-11H2,1-5H3/b7-6-/t12-/m0/s1 |
| InChIKey | MBZRBZPCFVSWKW-DGMVEKRQSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|