C14H25F3O2Si — CID 140749986
(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enal (PubChem CID 140749986) has the molecular formula C14H25F3O2Si and a molecular weight of 310.43 g/mol. Its IUPAC name is (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enal.
| Compound Name | (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enal |
|---|---|
| PubChem CID | 140749986 |
| Molecular Formula | C14H25F3O2Si |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC=O)C/C=C\CC(F)(F)F |
| InChI | InChI=1S/C14H25F3O2Si/c1-13(2,3)20(4,5)19-12(9-11-18)8-6-7-10-14(15,16)17/h6-7,11-12H,8-10H2,1-5H3/b7-6-/t12-/m0/s1 |
| InChIKey | BNYJJFLYRBLPHQ-DGMVEKRQSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|