C26H39F3O3Si — CID 140749989
(Z)-7-[(1S,5E)-5-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enal (PubChem CID 140749989) has the molecular formula C26H39F3O3Si and a molecular weight of 484.68 g/mol. Its IUPAC name is (Z)-7-[(1S,5E)-5-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enal.
| Compound Name | (Z)-7-[(1S,5E)-5-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enal |
|---|---|
| PubChem CID | 140749989 |
| Molecular Formula | C26H39F3O3Si |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (Z)-7-[(1S,5E)-5-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8,8,8-trifluorooct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C/C=C\CC(F)(F)F)C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCC=O |
| InChI | InChI=1S/C26H39F3O3Si/c1-25(2,3)33(4,5)32-22(14-10-11-19-26(27,28)29)16-17-23-21(15-18-24(23)31)13-9-7-6-8-12-20-30/h7,9-11,15,17-18,20-22H,6,8,12-14,16,19H2,1-5H3/b9-7-,11-10-,23-17+/t21-,22-/m0/s1 |
| InChIKey | VTKPXDHNVRYMFS-ZWSLKDTJSA-N |
| XLogP | 7.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|