C48H52FNOSi — CID 140750003
(5,8-dimethyl-10H-indeno[1,2-b]indol-10-yl)-[2-[(2-fluorophenyl)methyl]-9H-fluoren-9-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140750003) has the molecular formula C48H52FNOSi and a molecular weight of 706.03 g/mol. Its IUPAC name is (5,8-dimethyl-10H-indeno[1,2-b]indol-10-yl)-[2-[(2-fluorophenyl)methyl]-9H-fluoren-9-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | (5,8-dimethyl-10H-indeno[1,2-b]indol-10-yl)-[2-[(2-fluorophenyl)methyl]-9H-fluoren-9-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140750003 |
| Molecular Formula | C48H52FNOSi |
| Molecular Weight | 706.03 g/mol |
| Exact Mass | 705.38 |
| IUPAC Name | (5,8-dimethyl-10H-indeno[1,2-b]indol-10-yl)-[2-[(2-fluorophenyl)methyl]-9H-fluoren-9-yl]-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1ccc2c(c1)c1c(n2C)-c2ccccc2C1[Si](C)(CCCCCCOC(C)(C)C)C1c2ccccc2-c2ccc(Cc3ccccc3F)cc21 |
| InChI | InChI=1S/C48H52FNOSi/c1-32-23-26-43-41(29-32)44-45(50(43)5)37-19-11-13-21-39(37)47(44)52(6,28-16-8-7-15-27-51-48(2,3)4)46-38-20-12-10-18-35(38)36-25-24-33(31-40(36)46)30-34-17-9-14-22-42(34)49/h9-14,17-26,29,31,46-47H,7-8,15-16,27-28,30H2,1-6H3 |
| InChIKey | BIUYYTVWOXSJTA-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.03 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|