C22H34O8 — CID 140750024
1,3-bis[2-[2-(2-ethenoxyethoxy)ethoxy]ethoxy]benzene (PubChem CID 140750024) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1,3-bis[2-[2-(2-ethenoxyethoxy)ethoxy]ethoxy]benzene.
| Compound Name | 1,3-bis[2-[2-(2-ethenoxyethoxy)ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 140750024 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1,3-bis[2-[2-(2-ethenoxyethoxy)ethoxy]ethoxy]benzene |
| SMILES | C=COCCOCCOCCOc1cccc(OCCOCCOCCOC=C)c1 |
| InChI | InChI=1S/C22H34O8/c1-3-23-8-10-25-12-14-27-16-18-29-21-6-5-7-22(20-21)30-19-17-28-15-13-26-11-9-24-4-2/h3-7,20H,1-2,8-19H2 |
| InChIKey | RKIGSBFVOQDQKI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|