C13H17NO5 — CID 14075005
5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 14075005) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 14075005 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-hydroxy-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(NC(CCCO)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO5/c15-8-4-7-11(12(16)17)14-13(18)19-9-10-5-2-1-3-6-10/h1-3,5-6,11,15H,4,7-9H2,(H,14,18)(H,16,17) |
| InChIKey | WVGZTPNRQRMWEM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |