C28H56O3Si — CID 140750200
(11Z,14Z)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol (PubChem CID 140750200) has the molecular formula C28H56O3Si and a molecular weight of 468.84 g/mol. Its IUPAC name is (11Z,14Z)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol.
| Compound Name | (11Z,14Z)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol |
|---|---|
| PubChem CID | 140750200 |
| Molecular Formula | C28H56O3Si |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (11Z,14Z)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]icosa-11,14-dien-2-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)COCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O3Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(29)26-30-24-25-31-32(5,6)28(2,3)4/h11-12,14-15,27,29H,7-10,13,16-26H2,1-6H3/b12-11-,15-14- |
| InChIKey | GGSXASGLKFHMQD-HDXUUTQWSA-N |
| XLogP | 8.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|