C15H9NO2S — CID 14075043
spiro[1,3-thiazolidine-5,9'-fluorene]-2,4-dione (PubChem CID 14075043) has the molecular formula C15H9NO2S and a molecular weight of 267.31 g/mol. Its IUPAC name is spiro[1,3-thiazolidine-5,9'-fluorene]-2,4-dione.
| Compound Name | spiro[1,3-thiazolidine-5,9'-fluorene]-2,4-dione |
|---|---|
| PubChem CID | 14075043 |
| Molecular Formula | C15H9NO2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | spiro[1,3-thiazolidine-5,9'-fluorene]-2,4-dione |
| SMILES | O=C1NC(=O)C2(S1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C15H9NO2S/c17-13-15(19-14(18)16-13)11-7-3-1-5-9(11)10-6-2-4-8-12(10)15/h1-8H,(H,16,17,18) |
| InChIKey | VWMGJHRXYVRJMY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|