C9H11F7NO7S3- — CID 140750706
cyclohexyloxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonylazanide (PubChem CID 140750706) has the molecular formula C9H11F7NO7S3- and a molecular weight of 474.37 g/mol. Its IUPAC name is cyclohexyloxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonylazanide.
| Compound Name | cyclohexyloxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonylazanide |
|---|---|
| PubChem CID | 140750706 |
| Molecular Formula | C9H11F7NO7S3- |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | cyclohexyloxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-fluorosulfonylpropyl)sulfonylazanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)F)OC1CCCCC1 |
| InChI | InChI=1S/C9H11F7NO7S3/c10-7(11,8(12,13)25(16,18)19)9(14,15)26(20,21)17-27(22,23)24-6-4-2-1-3-5-6/h6H,1-5H2/q-1 |
| InChIKey | AXCCZFVTBXQWCK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 125.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|