About [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane
[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane (PubChem CID 140750843) has the molecular formula C16H39FO7Si3
and a molecular weight of 446.74 g/mol. Its IUPAC name is [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane |
| PubChem CID | 140750843 |
| Molecular Formula | C16H39FO7Si3 |
| Molecular Weight | 446.74 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane |
| SMILES | CO[Si](CCCC(F)(CCC[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C16H39FO7Si3/c1-18-26(19-2,20-3)14-10-12-16(17,24-25(7,8)9)13-11-15-27(21-4,22-5)23-6/h10-15H2,1-9H3 |
| InChIKey | FRBVVLOULHEGHA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane?
The IUPAC name of [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane (CID 140750843) is [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane.
What is the SMILES notation for [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane?
The canonical SMILES for [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane is CO[Si](CCCC(F)(CCC[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC.
What is the InChIKey of [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane?
The InChIKey is FRBVVLOULHEGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H39FO7Si3/c1-18-26(19-2,20-3)14-10-12-16(17,24-25(7,8)9)13-11-15-27(21-4,22-5)23-6/h10-15H2,1-9H3.
What are the key properties of [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane?
[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane has a molecular weight of 446.74 g/mol, XLogP of 3.82, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxy-trimethylsilane is sourced from PubChem (CID 140750843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).