About [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane
[5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane (PubChem CID 140750844) has the molecular formula C18H43FO7Si3
and a molecular weight of 474.79 g/mol. Its IUPAC name is [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane |
| PubChem CID | 140750844 |
| Molecular Formula | C18H43FO7Si3 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane |
| SMILES | CO[Si](CCCCC(F)(CCCC[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C18H43FO7Si3/c1-20-28(21-2,22-3)16-12-10-14-18(19,26-27(7,8)9)15-11-13-17-29(23-4,24-5)25-6/h10-17H2,1-9H3 |
| InChIKey | ROBPSFQYGOUEEQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane?
The IUPAC name of [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane (CID 140750844) is [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane.
What is the SMILES notation for [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane?
The canonical SMILES for [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane is CO[Si](CCCCC(F)(CCCC[Si](OC)(OC)OC)O[Si](C)(C)C)(OC)OC.
What is the InChIKey of [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane?
The InChIKey is ROBPSFQYGOUEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H43FO7Si3/c1-20-28(21-2,22-3)16-12-10-14-18(19,26-27(7,8)9)15-11-13-17-29(23-4,24-5)25-6/h10-17H2,1-9H3.
What are the key properties of [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane?
[5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane has a molecular weight of 474.79 g/mol, XLogP of 4.60, 18 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-1,9-bis(trimethoxysilyl)nonan-5-yl]oxy-trimethylsilane is sourced from PubChem (CID 140750844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).