About triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane
triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane (PubChem CID 140750845) has the molecular formula C19H45FO7Si3
and a molecular weight of 488.82 g/mol. Its IUPAC name is triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane |
| PubChem CID | 140750845 |
| Molecular Formula | C19H45FO7Si3 |
| Molecular Weight | 488.82 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC(F)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C19H45FO7Si3/c1-10-28(11-2,12-3)27-19(20,15-13-17-29(21-4,22-5)23-6)16-14-18-30(24-7,25-8)26-9/h10-18H2,1-9H3 |
| InChIKey | JPJHDDULYIJCKK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.82 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane?
The IUPAC name of triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane (CID 140750845) is triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane.
What is the SMILES notation for triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane?
The canonical SMILES for triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane is CC[Si](CC)(CC)OC(F)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC.
What is the InChIKey of triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane?
The InChIKey is JPJHDDULYIJCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H45FO7Si3/c1-10-28(11-2,12-3)27-19(20,15-13-17-29(21-4,22-5)23-6)16-14-18-30(24-7,25-8)26-9/h10-18H2,1-9H3.
What are the key properties of triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane?
triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane has a molecular weight of 488.82 g/mol, XLogP of 4.99, 19 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[4-fluoro-1,7-bis(trimethoxysilyl)heptan-4-yl]oxysilane is sourced from PubChem (CID 140750845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).