C18H27N3O6 — CID 140750979
1,3,5-tris(1-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 140750979) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1,3,5-tris(1-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(1-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 140750979 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1,3,5-tris(1-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCOC(C)n1c(=O)n(C(C)OCC=C)c(=O)n(C(C)OCC=C)c1=O |
| InChI | InChI=1S/C18H27N3O6/c1-7-10-25-13(4)19-16(22)20(14(5)26-11-8-2)18(24)21(17(19)23)15(6)27-12-9-3/h7-9,13-15H,1-3,10-12H2,4-6H3 |
| InChIKey | AIGVWDNOYZUIET-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|