About dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one
dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one (PubChem CID 140751594) has the molecular formula C12H20Cl2CoN2O2
and a molecular weight of 354.14 g/mol. Its IUPAC name is dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one.
Molecular Properties
| Compound Name | dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one |
| PubChem CID | 140751594 |
| Molecular Formula | C12H20Cl2CoN2O2 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one |
| SMILES | CC(=O)C/C(C)=N/CC/N=C(\C)CC(C)=O.Cl[Co]Cl |
| InChI | InChI=1S/C12H20N2O2.2ClH.Co/c1-9(7-11(3)15)13-5-6-14-10(2)8-12(4)16;;;/h5-8H2,1-4H3;2*1H;/q;;;+2/p-2/b13-9+,14-10+;;; |
| InChIKey | YCRVOIUKXIFAQR-BMEOSKMQSA-L |
| XLogP | 3.24 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one?
The IUPAC name of dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one (CID 140751594) is dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one.
What is the SMILES notation for dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one?
The canonical SMILES for dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one is CC(=O)C/C(C)=N/CC/N=C(\C)CC(C)=O.Cl[Co]Cl.
What is the InChIKey of dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one?
The InChIKey is YCRVOIUKXIFAQR-BMEOSKMQSA-L. The full InChI is InChI=1S/C12H20N2O2.2ClH.Co/c1-9(7-11(3)15)13-5-6-14-10(2)8-12(4)16;;;/h5-8H2,1-4H3;2*1H;/q;;;+2/p-2/b13-9+,14-10+;;;.
What are the key properties of dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one?
dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one has a molecular weight of 354.14 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt;4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one is sourced from PubChem (CID 140751594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).