C18H24N2O3 — CID 140753552
3-methyl-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-triene-9,15-dione (PubChem CID 140753552) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-methyl-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-triene-9,15-dione.
| Compound Name | 3-methyl-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-triene-9,15-dione |
|---|---|
| PubChem CID | 140753552 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-methyl-2-oxa-8,14-diazatricyclo[14.3.1.04,8]icosa-1(19),16(20),17-triene-9,15-dione |
| SMILES | CC1Oc2cccc(c2)C(=O)NCCCCC(=O)N2CCCC12 |
| InChI | InChI=1S/C18H24N2O3/c1-13-16-8-5-11-20(16)17(21)9-2-3-10-19-18(22)14-6-4-7-15(12-14)23-13/h4,6-7,12-13,16H,2-3,5,8-11H2,1H3,(H,19,22) |
| InChIKey | IGULPWDLQWTXDB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |