About (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one
(Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one (PubChem CID 140753656) has the molecular formula C18H38O3Si2
and a molecular weight of 358.67 g/mol. Its IUPAC name is (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one.
Molecular Properties
| Compound Name | (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one |
| PubChem CID | 140753656 |
| Molecular Formula | C18H38O3Si2 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one |
| SMILES | C[C@@H](/C=C\C(=O)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O3Si2/c1-15(21-23(10,11)18(5,6)7)12-13-16(19)14-20-22(8,9)17(2,3)4/h12-13,15H,14H2,1-11H3/b13-12-/t15-/m0/s1 |
| InChIKey | KFPKCUYNGINXOG-LLNWESEBSA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one?
The IUPAC name of (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one (CID 140753656) is (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one.
What is the SMILES notation for (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one?
The canonical SMILES for (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one is C[C@@H](/C=C\C(=O)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one?
The InChIKey is KFPKCUYNGINXOG-LLNWESEBSA-N. The full InChI is InChI=1S/C18H38O3Si2/c1-15(21-23(10,11)18(5,6)7)12-13-16(19)14-20-22(8,9)17(2,3)4/h12-13,15H,14H2,1-11H3/b13-12-/t15-/m0/s1.
What are the key properties of (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one?
(Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one has a molecular weight of 358.67 g/mol, XLogP of 5.54, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-en-2-one is sourced from PubChem (CID 140753656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).