C12H27NO2Si — CID 140754015
3-(2-ethyl-5,5-dimethyl-1,3,2-dioxasilinan-2-yl)-N,N-dimethylpropan-1-amine (PubChem CID 140754015) has the molecular formula C12H27NO2Si and a molecular weight of 245.44 g/mol. Its IUPAC name is 3-(2-ethyl-5,5-dimethyl-1,3,2-dioxasilinan-2-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-ethyl-5,5-dimethyl-1,3,2-dioxasilinan-2-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 140754015 |
| Molecular Formula | C12H27NO2Si |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-(2-ethyl-5,5-dimethyl-1,3,2-dioxasilinan-2-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CC[Si]1(CCCN(C)C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H27NO2Si/c1-6-16(9-7-8-13(4)5)14-10-12(2,3)11-15-16/h6-11H2,1-5H3 |
| InChIKey | PGHZAMJWZQJCQG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|