About 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine
5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 140755419) has the molecular formula C7H8N6
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine |
| PubChem CID | 140755419 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(-c2nc(N)n[nH]2)ncn1 |
| InChI | InChI=1S/C7H8N6/c1-4-2-5(10-3-9-4)6-11-7(8)13-12-6/h2-3H,1H3,(H3,8,11,12,13) |
| InChIKey | SEVSZWXUVNEYKU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine (CID 140755419) is 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine is Cc1cc(-c2nc(N)n[nH]2)ncn1.
What is the InChIKey of 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine?
The InChIKey is SEVSZWXUVNEYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6/c1-4-2-5(10-3-9-4)6-11-7(8)13-12-6/h2-3H,1H3,(H3,8,11,12,13).
What are the key properties of 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine?
5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine has a molecular weight of 176.18 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-methylpyrimidin-4-yl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 140755419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).