About prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate
prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate (PubChem CID 14075600) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate |
| PubChem CID | 14075600 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate |
| SMILES | C=CCOC(=O)Nc1c(=O)[nH]c(C)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C16H18N2O5/c1-5-6-23-16(20)18-14-11-8-13(22-4)12(21-3)7-10(11)9(2)17-15(14)19/h5,7-8H,1,6H2,2-4H3,(H,17,19)(H,18,20) |
| InChIKey | XFQBQSOBVXHHTC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate?
The IUPAC name of prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate (CID 14075600) is prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate.
What is the SMILES notation for prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate?
The canonical SMILES for prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate is C=CCOC(=O)Nc1c(=O)[nH]c(C)c2cc(OC)c(OC)cc12.
What is the InChIKey of prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate?
The InChIKey is XFQBQSOBVXHHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c1-5-6-23-16(20)18-14-11-8-13(22-4)12(21-3)7-10(11)9(2)17-15(14)19/h5,7-8H,1,6H2,2-4H3,(H,17,19)(H,18,20).
What are the key properties of prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate?
prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate has a molecular weight of 318.33 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-(6,7-dimethoxy-1-methyl-3-oxo-2H-isoquinolin-4-yl)carbamate is sourced from PubChem (CID 14075600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).