C17H19N7NaO2- — CID 140756236
sodium;[7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]methanone;hydroxide (PubChem CID 140756236) has the molecular formula C17H19N7NaO2- and a molecular weight of 376.38 g/mol. Its IUPAC name is sodium;[7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]methanone;hydroxide.
| Compound Name | sodium;[7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]methanone;hydroxide |
|---|---|
| PubChem CID | 140756236 |
| Molecular Formula | C17H19N7NaO2- |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | sodium;[7-[(1,5-dimethylpyrazol-3-yl)amino]-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]methanone;hydroxide |
| SMILES | CCn1c([C-]=O)cc2c3c(ncn3C)c(Nc3cc(C)n(C)n3)nc21.[Na+].[OH-] |
| InChI | InChI=1S/C17H18N7O.Na.H2O/c1-5-24-11(8-25)7-12-15-14(18-9-22(15)3)16(20-17(12)24)19-13-6-10(2)23(4)21-13;;/h6-7,9H,5H2,1-4H3,(H,19,20,21);;1H2/q-1;+1;/p-1 |
| InChIKey | HNWLJZDHSONLPP-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 112.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|