C29H28N5O2+ — CID 140757727
N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-12-[(3,5-dimethyl-4H-pyrazol-4-ylium-1-yl)methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide (PubChem CID 140757727) has the molecular formula C29H28N5O2+ and a molecular weight of 478.58 g/mol. Its IUPAC name is N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-12-[(3,5-dimethyl-4H-pyrazol-4-ylium-1-yl)methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide.
| Compound Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-12-[(3,5-dimethyl-4H-pyrazol-4-ylium-1-yl)methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
|---|---|
| PubChem CID | 140757727 |
| Molecular Formula | C29H28N5O2+ |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[(6-amino-2,4-dimethyl-3-pyridinyl)methyl]-12-[(3,5-dimethyl-4H-pyrazol-4-ylium-1-yl)methyl]-15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2(7),3,5,9(14),10,12-hexaene-4-carboxamide |
| SMILES | CC1=[C+]C(C)=NN1Cc1ccc2c(c1)C1OC2c2ccc(C(=O)NCc3c(C)cc(N)nc3C)cc21 |
| InChI | InChI=1S/C29H27N5O2/c1-15-9-26(30)32-18(4)25(15)13-31-29(35)20-6-8-22-24(12-20)28-23-11-19(5-7-21(23)27(22)36-28)14-34-17(3)10-16(2)33-34/h5-9,11-12,27-28H,13-14H2,1-4H3,(H2-,30,31,32,35)/p+1 |
| InChIKey | JYJBRCYMUNIFHV-UHFFFAOYSA-O |
| XLogP | 4.63 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|