C49H43NOSi — CID 140758777
N-(12,12,22,22-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)-N-(4-trimethylsilylphenyl)dibenzofuran-4-amine (PubChem CID 140758777) has the molecular formula C49H43NOSi and a molecular weight of 689.98 g/mol. Its IUPAC name is N-(12,12,22,22-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)-N-(4-trimethylsilylphenyl)dibenzofuran-4-amine.
| Compound Name | N-(12,12,22,22-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)-N-(4-trimethylsilylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 140758777 |
| Molecular Formula | C49H43NOSi |
| Molecular Weight | 689.98 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | N-(12,12,22,22-tetramethyl-19-hexacyclo[11.11.0.02,11.03,8.015,23.016,21]tetracosa-1(13),2(11),3,5,7,9,14,16(21),17,19,23-undecaenyl)-N-(4-trimethylsilylphenyl)dibenzofuran-4-amine |
| SMILES | CC1(C)c2cc(N(c3ccc([Si](C)(C)C)cc3)c3cccc4c3oc3ccccc34)ccc2-c2cc3c(cc21)-c1c(ccc2ccccc12)C3(C)C |
| InChI | InChI=1S/C49H43NOSi/c1-48(2)40-26-19-30-13-8-9-14-34(30)46(40)39-29-42-38(28-43(39)48)35-25-22-32(27-41(35)49(42,3)4)50(31-20-23-33(24-21-31)52(5,6)7)44-17-12-16-37-36-15-10-11-18-45(36)51-47(37)44/h8-29H,1-7H3 |
| InChIKey | QMJGKZPDZGBFHU-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.98 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|