C33H34F3N7O2S — CID 140758943
N-[1-[[1-(2-cyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-difluoroethylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide (PubChem CID 140758943) has the molecular formula C33H34F3N7O2S and a molecular weight of 649.74 g/mol. Its IUPAC name is N-[1-[[1-(2-cyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-difluoroethylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[[1-(2-cyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-difluoroethylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 140758943 |
| Molecular Formula | C33H34F3N7O2S |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | N-[1-[[1-(2-cyano-4,4-dimethylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-difluoroethylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)C=C(C#N)C(=O)N1CCCC1Cn1c(NC(=O)c2ccc(-c3ccnc(F)c3)s2)nc2cc(CNCC(F)F)ccc21 |
| InChI | InChI=1S/C33H34F3N7O2S/c1-33(2,3)15-22(16-37)31(45)42-12-4-5-23(42)19-43-25-7-6-20(17-38-18-28(34)35)13-24(25)40-32(43)41-30(44)27-9-8-26(46-27)21-10-11-39-29(36)14-21/h6-11,13-15,23,28,38H,4-5,12,17-19H2,1-3H3,(H,40,41,44) |
| InChIKey | VBFQGTZFUNIWCR-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|