C22H26N6O2S — CID 140759716
N-benzyl-1-[(13S)-11,13-dimethyl-2-oxo-6-thia-1,4,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-5-yl]pyrrolidine-2-carboxamide (PubChem CID 140759716) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-benzyl-1-[(13S)-11,13-dimethyl-2-oxo-6-thia-1,4,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-5-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-benzyl-1-[(13S)-11,13-dimethyl-2-oxo-6-thia-1,4,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-5-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140759716 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-benzyl-1-[(13S)-11,13-dimethyl-2-oxo-6-thia-1,4,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-5-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H]1CN(C)Cc2nc3sc(N4CCCC4C(=O)NCc4ccccc4)nc3c(=O)n21 |
| InChI | InChI=1S/C22H26N6O2S/c1-14-12-26(2)13-17-24-20-18(21(30)28(14)17)25-22(31-20)27-10-6-9-16(27)19(29)23-11-15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,9-13H2,1-2H3,(H,23,29)/t14-,16?/m0/s1 |
| InChIKey | WZGCZNFDGXOSMZ-LBAUFKAWSA-N |
| XLogP | 2.14 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |