About N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide
N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide (PubChem CID 140761409) has the molecular formula C15H17ClF3NO4S
and a molecular weight of 399.82 g/mol. Its IUPAC name is N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide.
Molecular Properties
| Compound Name | N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide |
| PubChem CID | 140761409 |
| Molecular Formula | C15H17ClF3NO4S |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)C(F)(Cl)OCC1CCCC(F)(F)C1)c1ccccc1 |
| InChI | InChI=1S/C15H17ClF3NO4S/c16-15(19,24-10-11-5-4-8-14(17,18)9-11)25(22,23)20-13(21)12-6-2-1-3-7-12/h1-3,6-7,11H,4-5,8-10H2,(H,20,21) |
| InChIKey | AWFWMBORMRAKBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide?
The IUPAC name of N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide (CID 140761409) is N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide.
What is the SMILES notation for N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide?
The canonical SMILES for N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide is O=C(NS(=O)(=O)C(F)(Cl)OCC1CCCC(F)(F)C1)c1ccccc1.
What is the InChIKey of N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide?
The InChIKey is AWFWMBORMRAKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClF3NO4S/c16-15(19,24-10-11-5-4-8-14(17,18)9-11)25(22,23)20-13(21)12-6-2-1-3-7-12/h1-3,6-7,11H,4-5,8-10H2,(H,20,21).
What are the key properties of N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide?
N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide has a molecular weight of 399.82 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[chloro-[(3,3-difluorocyclohexyl)methoxy]-fluoromethyl]sulfonylbenzamide is sourced from PubChem (CID 140761409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).