About N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide
N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide (PubChem CID 140761427) has the molecular formula C18H23F3N2O4S
and a molecular weight of 420.45 g/mol. Its IUPAC name is N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide.
Molecular Properties
| Compound Name | N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide |
| PubChem CID | 140761427 |
| Molecular Formula | C18H23F3N2O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide |
| SMILES | O=C(NS(=O)(=O)N(F)C(OCC1CCCC(F)(F)C1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C18H23F3N2O4S/c19-18(20)10-4-5-13(11-18)12-27-17(15-8-9-15)23(21)28(25,26)22-16(24)14-6-2-1-3-7-14/h1-3,6-7,13,15,17H,4-5,8-12H2,(H,22,24) |
| InChIKey | GTFLFUWDTMKENA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide?
The IUPAC name of N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide (CID 140761427) is N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide.
What is the SMILES notation for N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide?
The canonical SMILES for N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide is O=C(NS(=O)(=O)N(F)C(OCC1CCCC(F)(F)C1)C1CC1)c1ccccc1.
What is the InChIKey of N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide?
The InChIKey is GTFLFUWDTMKENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F3N2O4S/c19-18(20)10-4-5-13(11-18)12-27-17(15-8-9-15)23(21)28(25,26)22-16(24)14-6-2-1-3-7-14/h1-3,6-7,13,15,17H,4-5,8-12H2,(H,22,24).
What are the key properties of N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide?
N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide has a molecular weight of 420.45 g/mol, XLogP of 3.43, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[cyclopropyl-[(3,3-difluorocyclohexyl)methoxy]methyl]-fluorosulfamoyl]benzamide is sourced from PubChem (CID 140761427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).