C15H29NO2Si — CID 140761470
8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 140761470) has the molecular formula C15H29NO2Si and a molecular weight of 283.49 g/mol. Its IUPAC name is 8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | 8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 140761470 |
| Molecular Formula | C15H29NO2Si |
| Molecular Weight | 283.49 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC1CC2(CO[Si](C)(C)C(C)(C)C)CCCN2C1=O |
| InChI | InChI=1S/C15H29NO2Si/c1-12-10-15(8-7-9-16(15)13(12)17)11-18-19(5,6)14(2,3)4/h12H,7-11H2,1-6H3 |
| InChIKey | YMQUSBBRCBLVJM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|