C16H16N6O — CID 140761607
4-[5-isocyano-3-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine (PubChem CID 140761607) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-[5-isocyano-3-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine.
| Compound Name | 4-[5-isocyano-3-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine |
|---|---|
| PubChem CID | 140761607 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[5-isocyano-3-(1-methylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]morpholine |
| SMILES | [C-]#[N+]c1cnc2[nH]cc(-c3cnn(C)c3)c2c1N1CCOCC1 |
| InChI | InChI=1S/C16H16N6O/c1-17-13-9-19-16-14(15(13)22-3-5-23-6-4-22)12(8-18-16)11-7-20-21(2)10-11/h7-10H,3-6H2,2H3,(H,18,19) |
| InChIKey | IBUBWJWALOPGNX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|