C16H15BFNO5 — CID 140761946
N-(2,4-dimethoxyphenyl)-5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxamide (PubChem CID 140761946) has the molecular formula C16H15BFNO5 and a molecular weight of 331.11 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxamide |
|---|---|
| PubChem CID | 140761946 |
| Molecular Formula | C16H15BFNO5 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(cc2F)COB3O)c(OC)c1 |
| InChI | InChI=1S/C16H15BFNO5/c1-22-10-3-4-14(15(6-10)23-2)19-16(20)11-7-12-9(5-13(11)18)8-24-17(12)21/h3-7,21H,8H2,1-2H3,(H,19,20) |
| InChIKey | HPKAFTWVVVYRFD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|