C16H31NO4Si — CID 140762840
N-[(2,2-diethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-prop-2-enylprop-2-en-1-amine (PubChem CID 140762840) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is N-[(2,2-diethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-prop-2-enylprop-2-en-1-amine.
| Compound Name | N-[(2,2-diethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-prop-2-enylprop-2-en-1-amine |
|---|---|
| PubChem CID | 140762840 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-[(2,2-diethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCN(CC=C)CC1COCCC[Si](OCC)(OCC)O1 |
| InChI | InChI=1S/C16H31NO4Si/c1-5-10-17(11-6-2)14-16-15-18-12-9-13-22(21-16,19-7-3)20-8-4/h5-6,16H,1-2,7-15H2,3-4H3 |
| InChIKey | HRGDMGQCBKYRDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|