About (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol
(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol (PubChem CID 140762973) has the molecular formula C9H20F2O2Si
and a molecular weight of 226.34 g/mol. Its IUPAC name is (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol |
| PubChem CID | 140762973 |
| Molecular Formula | C9H20F2O2Si |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)C(F)F |
| InChI | InChI=1S/C9H20F2O2Si/c1-9(2,3)14(4,5)13-6-7(12)8(10)11/h7-8,12H,6H2,1-5H3/t7-/m1/s1 |
| InChIKey | RHNLFWVISDYSMV-SSDOTTSWSA-N |
| XLogP | 2.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol?
The IUPAC name of (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol (CID 140762973) is (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol.
What is the SMILES notation for (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol?
The canonical SMILES for (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol is CC(C)(C)[Si](C)(C)OC[C@@H](O)C(F)F.
What is the InChIKey of (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol?
The InChIKey is RHNLFWVISDYSMV-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H20F2O2Si/c1-9(2,3)14(4,5)13-6-7(12)8(10)11/h7-8,12H,6H2,1-5H3/t7-/m1/s1.
What are the key properties of (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol?
(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol has a molecular weight of 226.34 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol is sourced from PubChem (CID 140762973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).