C27H33FN6O2S — CID 140762978
(E)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 140762978) has the molecular formula C27H33FN6O2S and a molecular weight of 524.67 g/mol. Its IUPAC name is (E)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 140762978 |
| Molecular Formula | C27H33FN6O2S |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | (E)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCN(CCF)CC1)N1CCc2c(sc3ncnc(N[C@H](CO)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C27H33FN6O2S/c28-9-12-33-15-13-32(14-16-33)10-4-7-24(36)34-11-8-21-23(17-34)37-27-25(21)26(29-19-30-27)31-22(18-35)20-5-2-1-3-6-20/h1-7,19,22,35H,8-18H2,(H,29,30,31)/b7-4+/t22-/m1/s1 |
| InChIKey | AJBTWAYLRAEKBN-ZMTJCJBESA-N |
| XLogP | 2.86 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|