About 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one
4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one (PubChem CID 140762990) has the molecular formula C20H31ClO2Si
and a molecular weight of 367.01 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one.
Molecular Properties
| Compound Name | 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one |
| PubChem CID | 140762990 |
| Molecular Formula | C20H31ClO2Si |
| Molecular Weight | 367.01 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one |
| SMILES | CC(C)[Si](Oc1ccc(Cl)c2c1C(=O)C(C)(C)C2)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H31ClO2Si/c1-12(2)24(13(3)4,14(5)6)23-17-10-9-16(21)15-11-20(7,8)19(22)18(15)17/h9-10,12-14H,11H2,1-8H3 |
| InChIKey | TZRSXTMRIZQTAF-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.01 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one?
The IUPAC name of 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one (CID 140762990) is 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one.
What is the SMILES notation for 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one?
The canonical SMILES for 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one is CC(C)[Si](Oc1ccc(Cl)c2c1C(=O)C(C)(C)C2)(C(C)C)C(C)C.
What is the InChIKey of 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one?
The InChIKey is TZRSXTMRIZQTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31ClO2Si/c1-12(2)24(13(3)4,14(5)6)23-17-10-9-16(21)15-11-20(7,8)19(22)18(15)17/h9-10,12-14H,11H2,1-8H3.
What are the key properties of 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one?
4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one has a molecular weight of 367.01 g/mol, XLogP of 6.66, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,2-dimethyl-7-tri(propan-2-yl)silyloxy-3H-inden-1-one is sourced from PubChem (CID 140762990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).