C10H11N3O3S — CID 140762991
3-amino-N-(3-methyl-1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 140762991) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 3-amino-N-(3-methyl-1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 3-amino-N-(3-methyl-1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 140762991 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-amino-N-(3-methyl-1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nocc1NS(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C10H11N3O3S/c1-7-10(6-16-12-7)13-17(14,15)9-4-2-3-8(11)5-9/h2-6,13H,11H2,1H3 |
| InChIKey | LFRSAUWTKCBNPE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|