About 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole
4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole (PubChem CID 140763550) has the molecular formula C6HBr2FN2Se
and a molecular weight of 358.85 g/mol. Its IUPAC name is 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole.
Molecular Properties
| Compound Name | 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole |
| PubChem CID | 140763550 |
| Molecular Formula | C6HBr2FN2Se |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 357.77 |
| IUPAC Name | 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole |
| SMILES | Fc1cc(Br)c2n[se]nc2c1Br |
| InChI | InChI=1S/C6HBr2FN2Se/c7-2-1-3(9)4(8)6-5(2)10-12-11-6/h1H |
| InChIKey | SYJREORHRNUNPK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole?
The IUPAC name of 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole (CID 140763550) is 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole.
What is the SMILES notation for 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole?
The canonical SMILES for 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole is Fc1cc(Br)c2n[se]nc2c1Br.
What is the InChIKey of 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole?
The InChIKey is SYJREORHRNUNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBr2FN2Se/c7-2-1-3(9)4(8)6-5(2)10-12-11-6/h1H.
What are the key properties of 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole?
4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole has a molecular weight of 358.85 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dibromo-5-fluoro-2,1,3-benzoselenadiazole is sourced from PubChem (CID 140763550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).