C51H31Li2N5O2+2 — CID 140764576
dilithium;7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-(8-oxidoquinolin-1-ium-7-yl)benzo[a]anthracen-12-yl]quinolin-1-ium-8-olate (PubChem CID 140764576) has the molecular formula C51H31Li2N5O2+2 and a molecular weight of 759.72 g/mol. Its IUPAC name is dilithium;7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-(8-oxidoquinolin-1-ium-7-yl)benzo[a]anthracen-12-yl]quinolin-1-ium-8-olate.
| Compound Name | dilithium;7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-(8-oxidoquinolin-1-ium-7-yl)benzo[a]anthracen-12-yl]quinolin-1-ium-8-olate |
|---|---|
| PubChem CID | 140764576 |
| Molecular Formula | C51H31Li2N5O2+2 |
| Molecular Weight | 759.72 g/mol |
| Exact Mass | 759.28 |
| IUPAC Name | dilithium;7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-(8-oxidoquinolin-1-ium-7-yl)benzo[a]anthracen-12-yl]quinolin-1-ium-8-olate |
| SMILES | [Li+].[Li+].[O-]c1c(-c2c3ccccc3c(-c3ccc4ccc[nH+]c4c3[O-])c3c2ccc2c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc23)ccc2ccc[nH+]c12 |
| InChI | InChI=1S/C51H31N5O2.2Li/c57-47-40(24-22-30-16-10-28-52-45(30)47)42-36-18-7-8-19-37(36)44(41-25-23-31-17-11-29-53-46(31)48(41)58)43-35-20-9-21-38(34(35)26-27-39(42)43)51-55-49(32-12-3-1-4-13-32)54-50(56-51)33-14-5-2-6-15-33;;/h1-29,57-58H;;/q;2*+1 |
| InChIKey | KTTUHFVWQZRLCB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.72 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|