C10H10F3KN2O2 — CID 140764664
potassium 6-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylate (PubChem CID 140764664) has the molecular formula C10H10F3KN2O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is potassium 6-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylate.
| Compound Name | potassium 6-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140764664 |
| Molecular Formula | C10H10F3KN2O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | potassium 6-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-3-carboxylate |
| SMILES | O=C([O-])c1ncc2n1CC(CC(F)(F)F)CC2.[K+] |
| InChI | InChI=1S/C10H11F3N2O2.K/c11-10(12,13)3-6-1-2-7-4-14-8(9(16)17)15(7)5-6;/h4,6H,1-3,5H2,(H,16,17);/q;+1/p-1 |
| InChIKey | FDIMZTNJOCLZNN-UHFFFAOYSA-M |
| XLogP | -2.23 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |