About 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole
2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole (PubChem CID 140765109) has the molecular formula C24H15N3OS2
and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole |
| PubChem CID | 140765109 |
| Molecular Formula | C24H15N3OS2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole |
| SMILES | c1cc(Oc2cccc(-c3nc4sccc4s3)c2)cc(-c2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C24H15N3OS2/c1-2-11-27-15-20(25-22(27)9-1)16-5-3-7-18(13-16)28-19-8-4-6-17(14-19)23-26-24-21(30-23)10-12-29-24/h1-15H |
| InChIKey | LRBXDDNLRPRVJP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole?
The IUPAC name of 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole (CID 140765109) is 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole.
What is the SMILES notation for 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole?
The canonical SMILES for 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole is c1cc(Oc2cccc(-c3nc4sccc4s3)c2)cc(-c2cn3ccccc3n2)c1.
What is the InChIKey of 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole?
The InChIKey is LRBXDDNLRPRVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15N3OS2/c1-2-11-27-15-20(25-22(27)9-1)16-5-3-7-18(13-16)28-19-8-4-6-17(14-19)23-26-24-21(30-23)10-12-29-24/h1-15H.
What are the key properties of 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole?
2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole has a molecular weight of 425.54 g/mol, XLogP of 7.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-imidazo[1,2-a]pyridin-2-ylphenoxy)phenyl]thieno[2,3-d][1,3]thiazole is sourced from PubChem (CID 140765109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).