C20H40O2SSi — CID 140765678
tert-butyl-[(2E,4S,5R,6S,8Z)-3,5-dimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxy-dimethylsilane (PubChem CID 140765678) has the molecular formula C20H40O2SSi and a molecular weight of 372.69 g/mol. Its IUPAC name is tert-butyl-[(2E,4S,5R,6S,8Z)-3,5-dimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4S,5R,6S,8Z)-3,5-dimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140765678 |
| Molecular Formula | C20H40O2SSi |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | tert-butyl-[(2E,4S,5R,6S,8Z)-3,5-dimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxy-dimethylsilane |
| SMILES | C/C=C\C[C@H](OCSC)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C |
| InChI | InChI=1S/C20H40O2SSi/c1-11-13-14-18(21-15-23-8)17(4)19(16(3)12-2)22-24(9,10)20(5,6)7/h11-13,17-19H,14-15H2,1-10H3/b13-11-,16-12+/t17-,18+,19-/m1/s1 |
| InChIKey | ZGDMVPXOCXDLNX-KVHDQGSKSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|