C19H36O2Si — CID 140765681
(6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyldeca-2,8-dien-5-one (PubChem CID 140765681) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is (6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyldeca-2,8-dien-5-one.
| Compound Name | (6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyldeca-2,8-dien-5-one |
|---|---|
| PubChem CID | 140765681 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyldeca-2,8-dien-5-one |
| SMILES | C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-11-15(4)18(21-22(9,10)19(6,7)8)16(5)17(20)13-12-14(2)3/h11-12,16,18H,13H2,1-10H3/b15-11+/t16-,18+/m0/s1 |
| InChIKey | ZNCOJACFXYGHNB-HOXGWFAJSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|