C21H42O2SSi — CID 140765689
tert-butyl-dimethyl-[(2E,4R,5S,6R)-3,5,9-trimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxysilane (PubChem CID 140765689) has the molecular formula C21H42O2SSi and a molecular weight of 386.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4R,5S,6R)-3,5,9-trimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2E,4R,5S,6R)-3,5,9-trimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 140765689 |
| Molecular Formula | C21H42O2SSi |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4R,5S,6R)-3,5,9-trimethyl-6-(methylsulfanylmethoxy)deca-2,8-dien-4-yl]oxysilane |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CC=C(C)C)OCSC |
| InChI | InChI=1S/C21H42O2SSi/c1-12-17(4)20(23-25(10,11)21(6,7)8)18(5)19(22-15-24-9)14-13-16(2)3/h12-13,18-20H,14-15H2,1-11H3/b17-12+/t18-,19+,20-/m0/s1 |
| InChIKey | CDKUESUWGURPBD-DJOUCLFWSA-N |
| XLogP | 7.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|