C9H7N5O2 — CID 140765787
6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide (PubChem CID 140765787) has the molecular formula C9H7N5O2 and a molecular weight of 217.19 g/mol. Its IUPAC name is 6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide.
| Compound Name | 6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 140765787 |
| Molecular Formula | C9H7N5O2 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 6-oxo-2-pyrimidin-2-yl-1H-pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1cc(=O)[nH]c(-c2ncccn2)n1 |
| InChI | InChI=1S/C9H7N5O2/c10-7(16)5-4-6(15)14-9(13-5)8-11-2-1-3-12-8/h1-4H,(H2,10,16)(H,13,14,15) |
| InChIKey | BJBMIOSZBJGKNF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |